About [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate
[(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate (PubChem CID 15321599) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate.
Molecular Properties
| Compound Name | [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate |
| PubChem CID | 15321599 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate |
| SMILES | CC(=O)OC(CC(C)(O)CO)/C(C)=C/Cc1ccccc1 |
| InChI | InChI=1S/C17H24O4/c1-13(9-10-15-7-5-4-6-8-15)16(21-14(2)19)11-17(3,20)12-18/h4-9,16,18,20H,10-12H2,1-3H3/b13-9+ |
| InChIKey | PUFGWJFNOVUTMV-UKTHLTGXSA-N |
| XLogP | 2.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate?
The IUPAC name of [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate (CID 15321599) is [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate.
What is the SMILES notation for [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate?
The canonical SMILES for [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate is CC(=O)OC(CC(C)(O)CO)/C(C)=C/Cc1ccccc1.
What is the InChIKey of [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate?
The InChIKey is PUFGWJFNOVUTMV-UKTHLTGXSA-N. The full InChI is InChI=1S/C17H24O4/c1-13(9-10-15-7-5-4-6-8-15)16(21-14(2)19)11-17(3,20)12-18/h4-9,16,18,20H,10-12H2,1-3H3/b13-9+.
What are the key properties of [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate?
[(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate has a molecular weight of 292.38 g/mol, XLogP of 2.24, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-6,7-dihydroxy-3,6-dimethyl-1-phenylhept-2-en-4-yl] acetate is sourced from PubChem (CID 15321599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).