C20H28N4OS2 — CID 15321740
7,10-dipyridin-2-yl-1-oxa-4,13-dithia-7,10-diazacyclopentadecane (PubChem CID 15321740) has the molecular formula C20H28N4OS2 and a molecular weight of 404.61 g/mol. Its IUPAC name is 7,10-dipyridin-2-yl-1-oxa-4,13-dithia-7,10-diazacyclopentadecane.
| Compound Name | 7,10-dipyridin-2-yl-1-oxa-4,13-dithia-7,10-diazacyclopentadecane |
|---|---|
| PubChem CID | 15321740 |
| Molecular Formula | C20H28N4OS2 |
| Molecular Weight | 404.61 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 7,10-dipyridin-2-yl-1-oxa-4,13-dithia-7,10-diazacyclopentadecane |
| SMILES | c1ccc(N2CCSCCOCCSCCN(c3ccccn3)CC2)nc1 |
| InChI | InChI=1S/C20H28N4OS2/c1-3-7-21-19(5-1)23-9-10-24(20-6-2-4-8-22-20)12-16-27-18-14-25-13-17-26-15-11-23/h1-8H,9-18H2 |
| InChIKey | ZYLHPHIPCBVWFA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |