C12H10N4 — CID 15321801
(4-cyanoimino-5,6,7,8-tetrahydronaphthalen-1-ylidene)cyanamide (PubChem CID 15321801) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is (4-cyanoimino-5,6,7,8-tetrahydronaphthalen-1-ylidene)cyanamide.
| Compound Name | (4-cyanoimino-5,6,7,8-tetrahydronaphthalen-1-ylidene)cyanamide |
|---|---|
| PubChem CID | 15321801 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (4-cyanoimino-5,6,7,8-tetrahydronaphthalen-1-ylidene)cyanamide |
| SMILES | N#C/N=C1\C=C/C(=N\C#N)C2=C1CCCC2 |
| InChI | InChI=1S/C12H10N4/c13-7-15-11-5-6-12(16-8-14)10-4-2-1-3-9(10)11/h5-6H,1-4H2/b15-11+,16-12+ |
| InChIKey | WFIBMPFFRPXYGD-JOBJLJCHSA-N |
| XLogP | 2.27 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|