About 1-(bromomethyl)-3,5,7-trimethyladamantane
1-(bromomethyl)-3,5,7-trimethyladamantane (PubChem CID 15321812) has the molecular formula C14H23Br
and a molecular weight of 271.24 g/mol. Its IUPAC name is 1-(bromomethyl)-3,5,7-trimethyladamantane.
Molecular Properties
| Compound Name | 1-(bromomethyl)-3,5,7-trimethyladamantane |
| PubChem CID | 15321812 |
| Molecular Formula | C14H23Br |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-(bromomethyl)-3,5,7-trimethyladamantane |
| SMILES | CC12CC3(C)CC(C)(C1)CC(CBr)(C2)C3 |
| InChI | InChI=1S/C14H23Br/c1-11-4-12(2)6-13(3,5-11)9-14(7-11,8-12)10-15/h4-10H2,1-3H3 |
| InChIKey | LGMYLERUTRMOFY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-3,5,7-trimethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-3,5,7-trimethyladamantane?
The IUPAC name of 1-(bromomethyl)-3,5,7-trimethyladamantane (CID 15321812) is 1-(bromomethyl)-3,5,7-trimethyladamantane.
What is the SMILES notation for 1-(bromomethyl)-3,5,7-trimethyladamantane?
The canonical SMILES for 1-(bromomethyl)-3,5,7-trimethyladamantane is CC12CC3(C)CC(C)(C1)CC(CBr)(C2)C3.
What is the InChIKey of 1-(bromomethyl)-3,5,7-trimethyladamantane?
The InChIKey is LGMYLERUTRMOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23Br/c1-11-4-12(2)6-13(3,5-11)9-14(7-11,8-12)10-15/h4-10H2,1-3H3.
What are the key properties of 1-(bromomethyl)-3,5,7-trimethyladamantane?
1-(bromomethyl)-3,5,7-trimethyladamantane has a molecular weight of 271.24 g/mol, XLogP of 4.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-3,5,7-trimethyladamantane is sourced from PubChem (CID 15321812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).