About methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate
methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 15321815) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 15321815 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)N1CCCC=C1C#N |
| InChI | InChI=1S/C8H10N2O2/c1-12-8(11)10-5-3-2-4-7(10)6-9/h4H,2-3,5H2,1H3 |
| InChIKey | UDJKRWUAGPIVAT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate (CID 15321815) is methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate is COC(=O)N1CCCC=C1C#N.
What is the InChIKey of methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is UDJKRWUAGPIVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-12-8(11)10-5-3-2-4-7(10)6-9/h4H,2-3,5H2,1H3.
What are the key properties of methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate?
methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 166.18 g/mol, XLogP of 1.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-cyano-3,4-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 15321815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).