C6F11N — CID 15322150
3-(1,1,2,2,2-pentafluoroethyl)-2,2-bis(trifluoromethyl)azirine (PubChem CID 15322150) has the molecular formula C6F11N and a molecular weight of 295.05 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-2,2-bis(trifluoromethyl)azirine.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-2,2-bis(trifluoromethyl)azirine |
|---|---|
| PubChem CID | 15322150 |
| Molecular Formula | C6F11N |
| Molecular Weight | 295.05 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-2,2-bis(trifluoromethyl)azirine |
| SMILES | FC(F)(F)C(F)(F)C1=NC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F11N/c7-3(8,6(15,16)17)1-2(18-1,4(9,10)11)5(12,13)14 |
| InChIKey | UOTROHJDWINTAD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.05 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|