C46H73N7O11S — CID 153224648
2-[2-[4-[[5-cyano-2,6-bis[2-(8-hydroxy-2-methyl-3-oxooctan-2-yl)oxyethylamino]-4-methyl-3-pyridinyl]diazenyl]phenyl]sulfonylethyl-methylamino]ethyl 6-hydroxyhexanoate (PubChem CID 153224648) has the molecular formula C46H73N7O11S and a molecular weight of 932.19 g/mol. Its IUPAC name is 2-[2-[4-[[5-cyano-2,6-bis[2-(8-hydroxy-2-methyl-3-oxooctan-2-yl)oxyethylamino]-4-methyl-3-pyridinyl]diazenyl]phenyl]sulfonylethyl-methylamino]ethyl 6-hydroxyhexanoate.
| Compound Name | 2-[2-[4-[[5-cyano-2,6-bis[2-(8-hydroxy-2-methyl-3-oxooctan-2-yl)oxyethylamino]-4-methyl-3-pyridinyl]diazenyl]phenyl]sulfonylethyl-methylamino]ethyl 6-hydroxyhexanoate |
|---|---|
| PubChem CID | 153224648 |
| Molecular Formula | C46H73N7O11S |
| Molecular Weight | 932.19 g/mol |
| Exact Mass | 931.51 |
| IUPAC Name | 2-[2-[4-[[5-cyano-2,6-bis[2-(8-hydroxy-2-methyl-3-oxooctan-2-yl)oxyethylamino]-4-methyl-3-pyridinyl]diazenyl]phenyl]sulfonylethyl-methylamino]ethyl 6-hydroxyhexanoate |
| SMILES | Cc1c(C#N)c(NCCOC(C)(C)C(=O)CCCCCO)nc(NCCOC(C)(C)C(=O)CCCCCO)c1/N=N/c1ccc(S(=O)(=O)CCN(C)CCOC(=O)CCCCCO)cc1 |
| InChI | InChI=1S/C46H73N7O11S/c1-35-38(34-47)43(48-23-30-63-45(2,3)39(57)16-10-7-13-27-54)50-44(49-24-31-64-46(4,5)40(58)17-11-8-14-28-55)42(35)52-51-36-19-21-37(22-20-36)65(60,61)33-26-53(6)25-32-62-41(59)18-12-9-15-29-56/h19-22,54-56H,7-18,23-33H2,1-6H3,(H2,48,49,50)/b52-51+ |
| InChIKey | WOISCYIYNBTXER-WYYOLBRMSA-N |
| XLogP | 6.14 |
| TPSA | 262.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.19 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|