About 3-(1-ethoxyethyl)-1,1-diethylthiourea
3-(1-ethoxyethyl)-1,1-diethylthiourea (PubChem CID 15322499) has the molecular formula C9H20N2OS
and a molecular weight of 204.34 g/mol. Its IUPAC name is 3-(1-ethoxyethyl)-1,1-diethylthiourea.
Molecular Properties
| Compound Name | 3-(1-ethoxyethyl)-1,1-diethylthiourea |
| PubChem CID | 15322499 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-(1-ethoxyethyl)-1,1-diethylthiourea |
| SMILES | CCOC(C)NC(=S)N(CC)CC |
| InChI | InChI=1S/C9H20N2OS/c1-5-11(6-2)9(13)10-8(4)12-7-3/h8H,5-7H2,1-4H3,(H,10,13) |
| InChIKey | GWAPBVNCPMRRHG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-ethoxyethyl)-1,1-diethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethoxyethyl)-1,1-diethylthiourea?
The IUPAC name of 3-(1-ethoxyethyl)-1,1-diethylthiourea (CID 15322499) is 3-(1-ethoxyethyl)-1,1-diethylthiourea.
What is the SMILES notation for 3-(1-ethoxyethyl)-1,1-diethylthiourea?
The canonical SMILES for 3-(1-ethoxyethyl)-1,1-diethylthiourea is CCOC(C)NC(=S)N(CC)CC.
What is the InChIKey of 3-(1-ethoxyethyl)-1,1-diethylthiourea?
The InChIKey is GWAPBVNCPMRRHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2OS/c1-5-11(6-2)9(13)10-8(4)12-7-3/h8H,5-7H2,1-4H3,(H,10,13).
What are the key properties of 3-(1-ethoxyethyl)-1,1-diethylthiourea?
3-(1-ethoxyethyl)-1,1-diethylthiourea has a molecular weight of 204.34 g/mol, XLogP of 1.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethoxyethyl)-1,1-diethylthiourea is sourced from PubChem (CID 15322499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).