C15H17NO — CID 15322530
1-methoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline (PubChem CID 15322530) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-methoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline.
| Compound Name | 1-methoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline |
|---|---|
| PubChem CID | 15322530 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-methoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline |
| SMILES | COc1cccc2nc3c(cc12)CCCCC3 |
| InChI | InChI=1S/C15H17NO/c1-17-15-9-5-8-14-12(15)10-11-6-3-2-4-7-13(11)16-14/h5,8-10H,2-4,6-7H2,1H3 |
| InChIKey | UKVGWTNJCXNODL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |