C8H11N3O3 — CID 15322699
1,3-dimethyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 15322699) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 1,3-dimethyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15322699 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 1,3-dimethyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H11N3O3/c1-4-5-11-7(13)9(2)6(12)10(3)8(11)14/h4H,1,5H2,2-3H3 |
| InChIKey | JAJDXONFQWQAGK-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|