C16H26O4 — CID 153227513
tert-butyl 2-[(3aS,5R,6S,6aR)-3a-acetyl-6-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]acetate (PubChem CID 153227513) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is tert-butyl 2-[(3aS,5R,6S,6aR)-3a-acetyl-6-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]acetate.
| Compound Name | tert-butyl 2-[(3aS,5R,6S,6aR)-3a-acetyl-6-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]acetate |
|---|---|
| PubChem CID | 153227513 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | tert-butyl 2-[(3aS,5R,6S,6aR)-3a-acetyl-6-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]acetate |
| SMILES | CC(=O)[C@@]12CCO[C@@H]1[C@@H](C)[C@@H](CC(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C16H26O4/c1-10-12(8-13(18)20-15(3,4)5)9-16(11(2)17)6-7-19-14(10)16/h10,12,14H,6-9H2,1-5H3/t10-,12-,14+,16-/m0/s1 |
| InChIKey | WOWWWLQTKNYAIE-JPYFCXBMSA-N |
| XLogP | 2.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |