C15H25N3 — CID 15322896
4-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-diamine (PubChem CID 15322896) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 4-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 15322896 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 4-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-diamine |
| SMILES | CC1(C)CC(Nc2ccc(N)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C15H25N3/c1-14(2)9-13(10-15(3,4)18-14)17-12-7-5-11(16)6-8-12/h5-8,13,17-18H,9-10,16H2,1-4H3 |
| InChIKey | HYIJEWOVQCBEDL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|