C26H22N2O — CID 15322970
9-methoxy-2,3-dimethyl-5,7-diphenyl-1H-pyrrolo[3,2-g]quinoline (PubChem CID 15322970) has the molecular formula C26H22N2O and a molecular weight of 378.48 g/mol. Its IUPAC name is 9-methoxy-2,3-dimethyl-5,7-diphenyl-1H-pyrrolo[3,2-g]quinoline.
| Compound Name | 9-methoxy-2,3-dimethyl-5,7-diphenyl-1H-pyrrolo[3,2-g]quinoline |
|---|---|
| PubChem CID | 15322970 |
| Molecular Formula | C26H22N2O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 9-methoxy-2,3-dimethyl-5,7-diphenyl-1H-pyrrolo[3,2-g]quinoline |
| SMILES | COc1c2nc(-c3ccccc3)cc(-c3ccccc3)c2cc2c(C)c(C)[nH]c12 |
| InChI | InChI=1S/C26H22N2O/c1-16-17(2)27-24-20(16)14-22-21(18-10-6-4-7-11-18)15-23(19-12-8-5-9-13-19)28-25(22)26(24)29-3/h4-15,27H,1-3H3 |
| InChIKey | ATEYCKOVJYJKCT-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|