About 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol
3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol (PubChem CID 15323038) has the molecular formula C10H23NO4
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol |
| PubChem CID | 15323038 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol |
| SMILES | CCCCNCC(O)COCC(O)CO |
| InChI | InChI=1S/C10H23NO4/c1-2-3-4-11-5-9(13)7-15-8-10(14)6-12/h9-14H,2-8H2,1H3 |
| InChIKey | PWWIJDZZSAYNIA-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol?
The IUPAC name of 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol (CID 15323038) is 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol.
What is the SMILES notation for 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol?
The canonical SMILES for 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol is CCCCNCC(O)COCC(O)CO.
What is the InChIKey of 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol?
The InChIKey is PWWIJDZZSAYNIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO4/c1-2-3-4-11-5-9(13)7-15-8-10(14)6-12/h9-14H,2-8H2,1H3.
What are the key properties of 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol?
3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol has a molecular weight of 221.30 g/mol, XLogP of -0.89, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(butylamino)-2-hydroxypropoxy]propane-1,2-diol is sourced from PubChem (CID 15323038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).