C17H12Cl3N5O3 — CID 15323349
N-[(1Z)-1-(benzotriazol-1-yl)-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]-4-methoxyaniline (PubChem CID 15323349) has the molecular formula C17H12Cl3N5O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is N-[(1Z)-1-(benzotriazol-1-yl)-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]-4-methoxyaniline.
| Compound Name | N-[(1Z)-1-(benzotriazol-1-yl)-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 15323349 |
| Molecular Formula | C17H12Cl3N5O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | N-[(1Z)-1-(benzotriazol-1-yl)-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]-4-methoxyaniline |
| SMILES | COc1ccc(N/C(=C(\C(Cl)=C(Cl)Cl)[N+](=O)[O-])n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C17H12Cl3N5O3/c1-28-11-8-6-10(7-9-11)21-17(15(25(26)27)14(18)16(19)20)24-13-5-3-2-4-12(13)22-23-24/h2-9,21H,1H3/b17-15- |
| InChIKey | RJQYIQVBRAQWTE-ICFOKQHNSA-N |
| XLogP | 4.84 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|