C31H25Cl2F3IN5O3 — CID 153234870
[4-chloro-3-(4-chlorophenoxy)-2-[3-(1-iodoethoxy)azetidin-1-yl]quinolin-6-yl]-(3-methylimidazol-4-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanol (PubChem CID 153234870) has the molecular formula C31H25Cl2F3IN5O3 and a molecular weight of 770.38 g/mol. Its IUPAC name is [4-chloro-3-(4-chlorophenoxy)-2-[3-(1-iodoethoxy)azetidin-1-yl]quinolin-6-yl]-(3-methylimidazol-4-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanol.
| Compound Name | [4-chloro-3-(4-chlorophenoxy)-2-[3-(1-iodoethoxy)azetidin-1-yl]quinolin-6-yl]-(3-methylimidazol-4-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 153234870 |
| Molecular Formula | C31H25Cl2F3IN5O3 |
| Molecular Weight | 770.38 g/mol |
| Exact Mass | 769.03 |
| IUPAC Name | [4-chloro-3-(4-chlorophenoxy)-2-[3-(1-iodoethoxy)azetidin-1-yl]quinolin-6-yl]-(3-methylimidazol-4-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanol |
| SMILES | CC(I)OC1CN(c2nc3ccc(C(O)(c4ccc(C(F)(F)F)nc4)c4cncn4C)cc3c(Cl)c2Oc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C31H25Cl2F3IN5O3/c1-17(37)44-22-14-42(15-22)29-28(45-21-7-5-20(32)6-8-21)27(33)23-11-18(3-9-24(23)40-29)30(43,26-13-38-16-41(26)2)19-4-10-25(39-12-19)31(34,35)36/h3-13,16-17,22,43H,14-15H2,1-2H3 |
| InChIKey | WQHCAXIINBIMTB-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.38 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|