(9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid

C18H16BNO2 — CID 153238097

IUPAC(9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid
SMILESOB(O)c1ccc2c(c1)c1ccccc1n2C1=CC=CCC1
InChIInChI=1S/C18H16BNO2/c21-19(22)13-10-11-18-16(12-13)15-8-4-5-9-17(15)20(18)14-6-2-1-3-7-14/h1-2,4-6,8-12,21-22H,3,7H2
InChIKeyWQWWEWYQXGMCHZ-UHFFFAOYSA-N
MW289.14 g/mol
LogP2.67
Rot. Bonds2

About (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid

(9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid (PubChem CID 153238097) has the molecular formula C18H16BNO2 and a molecular weight of 289.14 g/mol. Its IUPAC name is (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid.

Molecular Properties

Compound Name(9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid
PubChem CID153238097
Molecular FormulaC18H16BNO2
Molecular Weight289.14 g/mol
Exact Mass289.13
IUPAC Name(9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid
SMILESOB(O)c1ccc2c(c1)c1ccccc1n2C1=CC=CCC1
InChIInChI=1S/C18H16BNO2/c21-19(22)13-10-11-18-16(12-13)15-8-4-5-9-17(15)20(18)14-6-2-1-3-7-14/h1-2,4-6,8-12,21-22H,3,7H2
InChIKeyWQWWEWYQXGMCHZ-UHFFFAOYSA-N
XLogP2.67
TPSA45.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.14
LogP ≤ 52.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid?
The IUPAC name of (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid (CID 153238097) is (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid.
What is the SMILES notation for (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid?
The canonical SMILES for (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid is OB(O)c1ccc2c(c1)c1ccccc1n2C1=CC=CCC1.
What is the InChIKey of (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid?
The InChIKey is WQWWEWYQXGMCHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BNO2/c21-19(22)13-10-11-18-16(12-13)15-8-4-5-9-17(15)20(18)14-6-2-1-3-7-14/h1-2,4-6,8-12,21-22H,3,7H2.
What are the key properties of (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid?
(9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid has a molecular weight of 289.14 g/mol, XLogP of 2.67, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9-cyclohexa-1,3-dien-1-ylcarbazol-3-yl)boronic acid is sourced from PubChem (CID 153238097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).