C23H24ClNO10 — CID 15323993
methyl 2,3,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-carboxylate perchlorate (PubChem CID 15323993) has the molecular formula C23H24ClNO10 and a molecular weight of 509.90 g/mol. Its IUPAC name is methyl 2,3,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-carboxylate perchlorate.
| Compound Name | methyl 2,3,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-carboxylate perchlorate |
|---|---|
| PubChem CID | 15323993 |
| Molecular Formula | C23H24ClNO10 |
| Molecular Weight | 509.90 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | methyl 2,3,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-carboxylate perchlorate |
| SMILES | COC(=O)c1c2[n+](cc3cc(OC)c(OC)cc13)CCc1cc(OC)c(OC)cc1-2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H24NO6.ClHO4/c1-26-17-8-13-6-7-24-12-14-9-18(27-2)19(28-3)10-15(14)21(23(25)30-5)22(24)16(13)11-20(17)29-4;2-1(3,4)5/h8-12H,6-7H2,1-5H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | YSBXNICEUWTJJD-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 159.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.90 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|