C31H31NO3S — CID 153242789
(17R)-N-(4-methoxyphenyl)-N-methyl-15-oxo-3-thiatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaene-17-carboxamide (PubChem CID 153242789) has the molecular formula C31H31NO3S and a molecular weight of 497.66 g/mol. Its IUPAC name is (17R)-N-(4-methoxyphenyl)-N-methyl-15-oxo-3-thiatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaene-17-carboxamide.
| Compound Name | (17R)-N-(4-methoxyphenyl)-N-methyl-15-oxo-3-thiatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaene-17-carboxamide |
|---|---|
| PubChem CID | 153242789 |
| Molecular Formula | C31H31NO3S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | (17R)-N-(4-methoxyphenyl)-N-methyl-15-oxo-3-thiatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaene-17-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)[C@H]2CC(=O)CC3=C(CSCc4cccc(c4)C2)Cc2ccccc23)cc1 |
| InChI | InChI=1S/C31H31NO3S/c1-32(26-10-12-28(35-2)13-11-26)31(34)24-15-21-6-5-7-22(14-21)19-36-20-25-16-23-8-3-4-9-29(23)30(25)18-27(33)17-24/h3-14,24H,15-20H2,1-2H3/t24-/m1/s1 |
| InChIKey | WRTSTRIOJPWVLE-XMMPIXPASA-N |
| XLogP | 6.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |