C9H12F6S2 — CID 15324458
(Z)-1-ethylsulfanyl-2,3,3,4,4,4-hexafluoro-1-propylsulfanylbut-1-ene (PubChem CID 15324458) has the molecular formula C9H12F6S2 and a molecular weight of 298.32 g/mol. Its IUPAC name is (Z)-1-ethylsulfanyl-2,3,3,4,4,4-hexafluoro-1-propylsulfanylbut-1-ene.
| Compound Name | (Z)-1-ethylsulfanyl-2,3,3,4,4,4-hexafluoro-1-propylsulfanylbut-1-ene |
|---|---|
| PubChem CID | 15324458 |
| Molecular Formula | C9H12F6S2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (Z)-1-ethylsulfanyl-2,3,3,4,4,4-hexafluoro-1-propylsulfanylbut-1-ene |
| SMILES | CCCS/C(SCC)=C(\F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6S2/c1-3-5-17-7(16-4-2)6(10)8(11,12)9(13,14)15/h3-5H2,1-2H3/b7-6- |
| InChIKey | ISRQODPRKQTSHK-SREVYHEPSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|