About 4-iodo-1-tritylpyrazole
4-iodo-1-tritylpyrazole (PubChem CID 15324479) has the molecular formula C22H17IN2
and a molecular weight of 436.30 g/mol. Its IUPAC name is 4-iodo-1-tritylpyrazole.
Molecular Properties
| Compound Name | 4-iodo-1-tritylpyrazole |
| PubChem CID | 15324479 |
| Molecular Formula | C22H17IN2 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 4-iodo-1-tritylpyrazole |
| SMILES | Ic1cnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H17IN2/c23-21-16-24-25(17-21)22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H |
| InChIKey | UJEYQAFIQWSUOR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-1-tritylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-1-tritylpyrazole?
The IUPAC name of 4-iodo-1-tritylpyrazole (CID 15324479) is 4-iodo-1-tritylpyrazole.
What is the SMILES notation for 4-iodo-1-tritylpyrazole?
The canonical SMILES for 4-iodo-1-tritylpyrazole is Ic1cnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 4-iodo-1-tritylpyrazole?
The InChIKey is UJEYQAFIQWSUOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17IN2/c23-21-16-24-25(17-21)22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H.
What are the key properties of 4-iodo-1-tritylpyrazole?
4-iodo-1-tritylpyrazole has a molecular weight of 436.30 g/mol, XLogP of 5.33, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-1-tritylpyrazole is sourced from PubChem (CID 15324479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).