About 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one
1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one (PubChem CID 15324535) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one.
Analyze 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one (CID 15324535) is 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one is COc1ccc(C(=O)C(C)(C)C)cc1C.
What is the InChIKey of 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one?
The InChIKey is MUQOYDOGGXLRIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-9-8-10(6-7-11(9)15-5)12(14)13(2,3)4/h6-8H,1-5H3.
What are the key properties of 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one?
1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one has a molecular weight of 206.28 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxy-3-methylphenyl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 15324535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).