About ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane
ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane (PubChem CID 153249667) has the molecular formula C10H11I
and a molecular weight of 258.10 g/mol. Its IUPAC name is ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane.
Molecular Properties
| Compound Name | ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane |
| PubChem CID | 153249667 |
| Molecular Formula | C10H11I |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane |
| SMILES | C=C/I=C/c1ccccc1C |
| InChI | InChI=1S/C10H11I/c1-3-11-8-10-7-5-4-6-9(10)2/h3-8H,1H2,2H3 |
| InChIKey | WTBLDUZTJFZSIQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane?
The IUPAC name of ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane (CID 153249667) is ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane.
What is the SMILES notation for ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane?
The canonical SMILES for ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane is C=C/I=C/c1ccccc1C.
What is the InChIKey of ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane?
The InChIKey is WTBLDUZTJFZSIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11I/c1-3-11-8-10-7-5-4-6-9(10)2/h3-8H,1H2,2H3.
What are the key properties of ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane?
ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane has a molecular weight of 258.10 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl-[(2-methylphenyl)methylidene]-λ3-iodane is sourced from PubChem (CID 153249667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).