About (2,4-dinitrophenyl) thiocyanate
(2,4-dinitrophenyl) thiocyanate (PubChem CID 15325) has the molecular formula C7H3N3O4S
and a molecular weight of 225.19 g/mol. Its IUPAC name is (2,4-dinitrophenyl) thiocyanate.
Molecular Properties
| Compound Name | (2,4-dinitrophenyl) thiocyanate |
| PubChem CID | 15325 |
| Molecular Formula | C7H3N3O4S |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | (2,4-dinitrophenyl) thiocyanate |
| SMILES | N#CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H3N3O4S/c8-4-15-7-2-1-5(9(11)12)3-6(7)10(13)14/h1-3H |
| InChIKey | XQDQRCRASHAZBA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dinitrophenyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dinitrophenyl) thiocyanate?
The IUPAC name of (2,4-dinitrophenyl) thiocyanate (CID 15325) is (2,4-dinitrophenyl) thiocyanate.
What is the SMILES notation for (2,4-dinitrophenyl) thiocyanate?
The canonical SMILES for (2,4-dinitrophenyl) thiocyanate is N#CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of (2,4-dinitrophenyl) thiocyanate?
The InChIKey is XQDQRCRASHAZBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N3O4S/c8-4-15-7-2-1-5(9(11)12)3-6(7)10(13)14/h1-3H.
What are the key properties of (2,4-dinitrophenyl) thiocyanate?
(2,4-dinitrophenyl) thiocyanate has a molecular weight of 225.19 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitrophenyl) thiocyanate is sourced from PubChem (CID 15325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).