C19H18N4O4S — CID 153256136
6-[(1-ethynylcyclopropyl)methylsulfonyl]-3-[(1-methylpyrazol-4-yl)methyl]-1H-quinazoline-2,4-dione (PubChem CID 153256136) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 6-[(1-ethynylcyclopropyl)methylsulfonyl]-3-[(1-methylpyrazol-4-yl)methyl]-1H-quinazoline-2,4-dione.
| Compound Name | 6-[(1-ethynylcyclopropyl)methylsulfonyl]-3-[(1-methylpyrazol-4-yl)methyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 153256136 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 6-[(1-ethynylcyclopropyl)methylsulfonyl]-3-[(1-methylpyrazol-4-yl)methyl]-1H-quinazoline-2,4-dione |
| SMILES | C#CC1(CS(=O)(=O)c2ccc3[nH]c(=O)n(Cc4cnn(C)c4)c(=O)c3c2)CC1 |
| InChI | InChI=1S/C19H18N4O4S/c1-3-19(6-7-19)12-28(26,27)14-4-5-16-15(8-14)17(24)23(18(25)21-16)11-13-9-20-22(2)10-13/h1,4-5,8-10H,6-7,11-12H2,2H3,(H,21,25) |
| InChIKey | WUHNEPJLZXNJDG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|