C11H18O3 — CID 15325822
(2R,6R)-5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one (PubChem CID 15325822) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (2R,6R)-5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one.
| Compound Name | (2R,6R)-5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 15325822 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (2R,6R)-5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one |
| SMILES | C=C1C(=O)O[C@H](C(C)C)O[C@@H]1C(C)C |
| InChI | InChI=1S/C11H18O3/c1-6(2)9-8(5)10(12)14-11(13-9)7(3)4/h6-7,9,11H,5H2,1-4H3/t9-,11-/m1/s1 |
| InChIKey | BCEFTGNRRKRKON-MWLCHTKSSA-N |
| XLogP | 2.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|