About 4-pyrrolidin-1-yl-1,3-thiazol-2-amine
4-pyrrolidin-1-yl-1,3-thiazol-2-amine (PubChem CID 15325944) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is 4-pyrrolidin-1-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-pyrrolidin-1-yl-1,3-thiazol-2-amine |
| PubChem CID | 15325944 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-pyrrolidin-1-yl-1,3-thiazol-2-amine |
| SMILES | Nc1nc(N2CCCC2)cs1 |
| InChI | InChI=1S/C7H11N3S/c8-7-9-6(5-11-7)10-3-1-2-4-10/h5H,1-4H2,(H2,8,9) |
| InChIKey | AXEDQKBAYNSQDH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-pyrrolidin-1-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrrolidin-1-yl-1,3-thiazol-2-amine?
The IUPAC name of 4-pyrrolidin-1-yl-1,3-thiazol-2-amine (CID 15325944) is 4-pyrrolidin-1-yl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-pyrrolidin-1-yl-1,3-thiazol-2-amine?
The canonical SMILES for 4-pyrrolidin-1-yl-1,3-thiazol-2-amine is Nc1nc(N2CCCC2)cs1.
What is the InChIKey of 4-pyrrolidin-1-yl-1,3-thiazol-2-amine?
The InChIKey is AXEDQKBAYNSQDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S/c8-7-9-6(5-11-7)10-3-1-2-4-10/h5H,1-4H2,(H2,8,9).
What are the key properties of 4-pyrrolidin-1-yl-1,3-thiazol-2-amine?
4-pyrrolidin-1-yl-1,3-thiazol-2-amine has a molecular weight of 169.25 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrolidin-1-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 15325944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).