About cyclononylmethyl carbamimidothioate
cyclononylmethyl carbamimidothioate (PubChem CID 153259731) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is cyclononylmethyl carbamimidothioate.
Molecular Properties
| Compound Name | cyclononylmethyl carbamimidothioate |
| PubChem CID | 153259731 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | cyclononylmethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC1CCCCCCCC1 |
| InChI | InChI=1S/C11H22N2S/c12-11(13)14-9-10-7-5-3-1-2-4-6-8-10/h10H,1-9H2,(H3,12,13) |
| InChIKey | WUZGJBAAPBACFN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclononylmethyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclononylmethyl carbamimidothioate?
The IUPAC name of cyclononylmethyl carbamimidothioate (CID 153259731) is cyclononylmethyl carbamimidothioate.
What is the SMILES notation for cyclononylmethyl carbamimidothioate?
The canonical SMILES for cyclononylmethyl carbamimidothioate is [H]/N=C(\N)SCC1CCCCCCCC1.
What is the InChIKey of cyclononylmethyl carbamimidothioate?
The InChIKey is WUZGJBAAPBACFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S/c12-11(13)14-9-10-7-5-3-1-2-4-6-8-10/h10H,1-9H2,(H3,12,13).
What are the key properties of cyclononylmethyl carbamimidothioate?
cyclononylmethyl carbamimidothioate has a molecular weight of 214.38 g/mol, XLogP of 3.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclononylmethyl carbamimidothioate is sourced from PubChem (CID 153259731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).