C29H31F7N2O4 — CID 153262716
1-[4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidin-1-yl]-2-methoxyethanone (PubChem CID 153262716) has the molecular formula C29H31F7N2O4 and a molecular weight of 604.56 g/mol. Its IUPAC name is 1-[4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 153262716 |
| Molecular Formula | C29H31F7N2O4 |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | 1-[4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(C(=O)N2C[C@@H](c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)[C@@](C)(c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C29H31F7N2O4/c1-26(20-7-9-22(30)10-8-20)17-38(25(40)19-11-13-37(14-12-19)24(39)16-42-2)15-23(26)18-3-5-21(6-4-18)27(41,28(31,32)33)29(34,35)36/h3-10,19,23,41H,11-17H2,1-2H3/t23-,26+/m0/s1 |
| InChIKey | WVOHMJUIXOIMSP-JYFHCDHNSA-N |
| XLogP | 4.91 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |