C13H17NO3 — CID 15326684
5-ethyl-2-(4-methoxyphenyl)-5-methyl-1,3-oxazolidin-4-one (PubChem CID 15326684) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 5-ethyl-2-(4-methoxyphenyl)-5-methyl-1,3-oxazolidin-4-one.
| Compound Name | 5-ethyl-2-(4-methoxyphenyl)-5-methyl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 15326684 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 5-ethyl-2-(4-methoxyphenyl)-5-methyl-1,3-oxazolidin-4-one |
| SMILES | CCC1(C)OC(c2ccc(OC)cc2)NC1=O |
| InChI | InChI=1S/C13H17NO3/c1-4-13(2)12(15)14-11(17-13)9-5-7-10(16-3)8-6-9/h5-8,11H,4H2,1-3H3,(H,14,15) |
| InChIKey | BPUXROKMVSWGFY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |