About pyrrolo[2,1-b][1,3]thiazole
pyrrolo[2,1-b][1,3]thiazole (PubChem CID 15326816) has the molecular formula C6H5NS
and a molecular weight of 123.18 g/mol. Its IUPAC name is pyrrolo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | pyrrolo[2,1-b][1,3]thiazole |
| PubChem CID | 15326816 |
| Molecular Formula | C6H5NS |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.01 |
| IUPAC Name | pyrrolo[2,1-b][1,3]thiazole |
| SMILES | c1cc2sccn2c1 |
| InChI | InChI=1S/C6H5NS/c1-2-6-7(3-1)4-5-8-6/h1-5H |
| InChIKey | MOVFAUAADQBPRE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,1-b][1,3]thiazole?
The IUPAC name of pyrrolo[2,1-b][1,3]thiazole (CID 15326816) is pyrrolo[2,1-b][1,3]thiazole.
What is the SMILES notation for pyrrolo[2,1-b][1,3]thiazole?
The canonical SMILES for pyrrolo[2,1-b][1,3]thiazole is c1cc2sccn2c1.
What is the InChIKey of pyrrolo[2,1-b][1,3]thiazole?
The InChIKey is MOVFAUAADQBPRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NS/c1-2-6-7(3-1)4-5-8-6/h1-5H.
What are the key properties of pyrrolo[2,1-b][1,3]thiazole?
pyrrolo[2,1-b][1,3]thiazole has a molecular weight of 123.18 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,1-b][1,3]thiazole is sourced from PubChem (CID 15326816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).