C27H27N3O2 — CID 15326833
2,4-di(piperidin-1-yl)naphtho[2,3-h]quinoline-7,12-dione (PubChem CID 15326833) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2,4-di(piperidin-1-yl)naphtho[2,3-h]quinoline-7,12-dione.
| Compound Name | 2,4-di(piperidin-1-yl)naphtho[2,3-h]quinoline-7,12-dione |
|---|---|
| PubChem CID | 15326833 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2,4-di(piperidin-1-yl)naphtho[2,3-h]quinoline-7,12-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1c(N3CCCCC3)cc(N3CCCCC3)nc21 |
| InChI | InChI=1S/C27H27N3O2/c31-26-18-9-3-4-10-19(18)27(32)24-21(26)12-11-20-22(29-13-5-1-6-14-29)17-23(28-25(20)24)30-15-7-2-8-16-30/h3-4,9-12,17H,1-2,5-8,13-16H2 |
| InChIKey | OKUJOEMMGGKFQP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|