About 3-ethyl-N,N-dimethylthiophen-2-amine
3-ethyl-N,N-dimethylthiophen-2-amine (PubChem CID 15326881) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is 3-ethyl-N,N-dimethylthiophen-2-amine.
Molecular Properties
| Compound Name | 3-ethyl-N,N-dimethylthiophen-2-amine |
| PubChem CID | 15326881 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 3-ethyl-N,N-dimethylthiophen-2-amine |
| SMILES | CCc1ccsc1N(C)C |
| InChI | InChI=1S/C8H13NS/c1-4-7-5-6-10-8(7)9(2)3/h5-6H,4H2,1-3H3 |
| InChIKey | AIPOXGHJSDOFCO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-N,N-dimethylthiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N,N-dimethylthiophen-2-amine?
The IUPAC name of 3-ethyl-N,N-dimethylthiophen-2-amine (CID 15326881) is 3-ethyl-N,N-dimethylthiophen-2-amine.
What is the SMILES notation for 3-ethyl-N,N-dimethylthiophen-2-amine?
The canonical SMILES for 3-ethyl-N,N-dimethylthiophen-2-amine is CCc1ccsc1N(C)C.
What is the InChIKey of 3-ethyl-N,N-dimethylthiophen-2-amine?
The InChIKey is AIPOXGHJSDOFCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-4-7-5-6-10-8(7)9(2)3/h5-6H,4H2,1-3H3.
What are the key properties of 3-ethyl-N,N-dimethylthiophen-2-amine?
3-ethyl-N,N-dimethylthiophen-2-amine has a molecular weight of 155.27 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N,N-dimethylthiophen-2-amine is sourced from PubChem (CID 15326881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).