C21H14BF5N2O3 — CID 153270924
CID 153270924 (PubChem CID 153270924) has the molecular formula C21H14BF5N2O3 and a molecular weight of 448.16 g/mol.
| Compound Name | CID 153270924 |
|---|---|
| PubChem CID | 153270924 |
| Molecular Formula | C21H14BF5N2O3 |
| Molecular Weight | 448.16 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C[C@H](NC(=O)c2c(F)cccc2F)C(=O)OC)c2cc(C(F)(F)F)cnc12 |
| InChI | InChI=1S/C21H14BF5N2O3/c1-32-20(31)16(29-19(30)17-14(23)3-2-4-15(17)24)7-10-5-6-13(22)18-12(10)8-11(9-28-18)21(25,26)27/h2-6,8-9,16H,7H2,1H3,(H,29,30)/t16-/m0/s1 |
| InChIKey | PPJPRZVYXJXCIC-INIZCTEOSA-N |
| XLogP | 2.84 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.16 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|