C28H32F2N8O2S — CID 153271178
N-[3-amino-6-(3,5-difluorophenyl)sulfanylpyrazine-2-carboximidoyl]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide (PubChem CID 153271178) has the molecular formula C28H32F2N8O2S and a molecular weight of 582.68 g/mol. Its IUPAC name is N-[3-amino-6-(3,5-difluorophenyl)sulfanylpyrazine-2-carboximidoyl]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide.
| Compound Name | N-[3-amino-6-(3,5-difluorophenyl)sulfanylpyrazine-2-carboximidoyl]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 153271178 |
| Molecular Formula | C28H32F2N8O2S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | N-[3-amino-6-(3,5-difluorophenyl)sulfanylpyrazine-2-carboximidoyl]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide |
| SMILES | [H]/N=C(/NC(=O)c1ccc(N2CCN(C)CC2)cc1NC1CCOCC1)c1nc(Sc2cc(F)cc(F)c2)cnc1N |
| InChI | InChI=1S/C28H32F2N8O2S/c1-37-6-8-38(9-7-37)20-2-3-22(23(15-20)34-19-4-10-40-11-5-19)28(39)36-27(32)25-26(31)33-16-24(35-25)41-21-13-17(29)12-18(30)14-21/h2-3,12-16,19,34H,4-11H2,1H3,(H2,31,33)(H2,32,36,39) |
| InChIKey | WXDSWOMSJVVTIF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|