C18H26O4 — CID 15327119
trans-diethyl (3R,4R)-3-[(1E)-buta-1,3-dienyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate (PubChem CID 15327119) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is trans-diethyl (3R,4R)-3-[(1E)-buta-1,3-dienyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3R,4R)-3-[(1E)-buta-1,3-dienyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15327119 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | trans-diethyl (3R,4R)-3-[(1E)-buta-1,3-dienyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C/C=C/[C@@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@H]1CC=C |
| InChI | InChI=1S/C18H26O4/c1-5-9-11-15-13-18(16(19)21-7-3,17(20)22-8-4)12-14(15)10-6-2/h5-6,9,11,14-15H,1-2,7-8,10,12-13H2,3-4H3/b11-9+/t14-,15-/m1/s1 |
| InChIKey | QNWRSGIMLPXUJN-IANUHJRKSA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|