C22H32O4 — CID 15327122
trans-diethyl (3R,4R)-3-[(E)-2-(cyclohexen-1-yl)ethenyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate (PubChem CID 15327122) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is trans-diethyl (3R,4R)-3-[(E)-2-(cyclohexen-1-yl)ethenyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3R,4R)-3-[(E)-2-(cyclohexen-1-yl)ethenyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15327122 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | trans-diethyl (3R,4R)-3-[(E)-2-(cyclohexen-1-yl)ethenyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate |
| SMILES | C=CC[C@@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@H]1/C=C/C1=CCCCC1 |
| InChI | InChI=1S/C22H32O4/c1-4-10-18-15-22(20(23)25-5-2,21(24)26-6-3)16-19(18)14-13-17-11-8-7-9-12-17/h4,11,13-14,18-19H,1,5-10,12,15-16H2,2-3H3/b14-13+/t18-,19-/m1/s1 |
| InChIKey | QQTKQTNWMUDINV-WKWPXIAWSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|