C22H37N3O7S2 — CID 153272086
2-[[6-(2-sulfoethylcarbamoyl)-4-[(E)-3,6,6-trimethyloct-4-en-3-yl]-2-pyridinyl]methylamino]ethanesulfonic acid (PubChem CID 153272086) has the molecular formula C22H37N3O7S2 and a molecular weight of 519.69 g/mol. Its IUPAC name is 2-[[6-(2-sulfoethylcarbamoyl)-4-[(E)-3,6,6-trimethyloct-4-en-3-yl]-2-pyridinyl]methylamino]ethanesulfonic acid.
| Compound Name | 2-[[6-(2-sulfoethylcarbamoyl)-4-[(E)-3,6,6-trimethyloct-4-en-3-yl]-2-pyridinyl]methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 153272086 |
| Molecular Formula | C22H37N3O7S2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 2-[[6-(2-sulfoethylcarbamoyl)-4-[(E)-3,6,6-trimethyloct-4-en-3-yl]-2-pyridinyl]methylamino]ethanesulfonic acid |
| SMILES | CCC(C)(C)/C=C/C(C)(CC)c1cc(CNCCS(=O)(=O)O)nc(C(=O)NCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C22H37N3O7S2/c1-6-21(3,4)8-9-22(5,7-2)17-14-18(16-23-10-12-33(27,28)29)25-19(15-17)20(26)24-11-13-34(30,31)32/h8-9,14-15,23H,6-7,10-13,16H2,1-5H3,(H,24,26)(H,27,28,29)(H,30,31,32)/b9-8+ |
| InChIKey | WXIIMVLUWPGEOC-CMDGGOBGSA-N |
| XLogP | 2.34 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|