C32H39F2N9O3 — CID 153272819
7-[4-[[6-[[5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-3-pyridinyl]methyl]piperazin-1-yl]-N-hydroxy-7-oxoheptanamide (PubChem CID 153272819) has the molecular formula C32H39F2N9O3 and a molecular weight of 635.72 g/mol. Its IUPAC name is 7-[4-[[6-[[5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-3-pyridinyl]methyl]piperazin-1-yl]-N-hydroxy-7-oxoheptanamide.
| Compound Name | 7-[4-[[6-[[5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-3-pyridinyl]methyl]piperazin-1-yl]-N-hydroxy-7-oxoheptanamide |
|---|---|
| PubChem CID | 153272819 |
| Molecular Formula | C32H39F2N9O3 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | 7-[4-[[6-[[5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-3-pyridinyl]methyl]piperazin-1-yl]-N-hydroxy-7-oxoheptanamide |
| SMILES | Cc1nc2c(F)cc(-c3nc(Nc4ccc(CN5CCN(C(=O)CCCCCC(=O)NO)CC5)cn4)ncc3F)cc2n1C(C)C |
| InChI | InChI=1S/C32H39F2N9O3/c1-20(2)43-21(3)37-31-24(33)15-23(16-26(31)43)30-25(34)18-36-32(39-30)38-27-10-9-22(17-35-27)19-41-11-13-42(14-12-41)29(45)8-6-4-5-7-28(44)40-46/h9-10,15-18,20,46H,4-8,11-14,19H2,1-3H3,(H,40,44)(H,35,36,38,39) |
| InChIKey | WXLUSCKDJFQSTP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|