C25H27NO — CID 15327282
(2R)-2-[(2R,6S)-2,6-diphenylpiperidin-1-yl]-2-phenylethanol (PubChem CID 15327282) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is (2R)-2-[(2R,6S)-2,6-diphenylpiperidin-1-yl]-2-phenylethanol.
| Compound Name | (2R)-2-[(2R,6S)-2,6-diphenylpiperidin-1-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 15327282 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (2R)-2-[(2R,6S)-2,6-diphenylpiperidin-1-yl]-2-phenylethanol |
| SMILES | OC[C@@H](c1ccccc1)N1[C@@H](c2ccccc2)CCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H27NO/c27-19-25(22-15-8-3-9-16-22)26-23(20-11-4-1-5-12-20)17-10-18-24(26)21-13-6-2-7-14-21/h1-9,11-16,23-25,27H,10,17-19H2/t23-,24+,25-/m0/s1 |
| InChIKey | XDNPXJNKBDIPMX-GVAUOCQISA-N |
| XLogP | 5.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |