C29H25ClN2O4S — CID 15327306
(2S)-N-(2-benzoyl-4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 15327306) has the molecular formula C29H25ClN2O4S and a molecular weight of 533.05 g/mol. Its IUPAC name is (2S)-N-(2-benzoyl-4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2S)-N-(2-benzoyl-4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 15327306 |
| Molecular Formula | C29H25ClN2O4S |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | (2S)-N-(2-benzoyl-4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25ClN2O4S/c1-20-12-15-24(16-13-20)37(35,36)32-27(18-21-8-4-2-5-9-21)29(34)31-26-17-14-23(30)19-25(26)28(33)22-10-6-3-7-11-22/h2-17,19,27,32H,18H2,1H3,(H,31,34)/t27-/m0/s1 |
| InChIKey | RKFRTBNIVHMDHU-MHZLTWQESA-N |
| XLogP | 5.41 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |