C9H13BrO4 — CID 15327475
methyl (E)-4-[2-(bromomethyl)-1,3-dioxolan-2-yl]but-2-enoate (PubChem CID 15327475) has the molecular formula C9H13BrO4 and a molecular weight of 265.10 g/mol. Its IUPAC name is methyl (E)-4-[2-(bromomethyl)-1,3-dioxolan-2-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[2-(bromomethyl)-1,3-dioxolan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 15327475 |
| Molecular Formula | C9H13BrO4 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | methyl (E)-4-[2-(bromomethyl)-1,3-dioxolan-2-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/CC1(CBr)OCCO1 |
| InChI | InChI=1S/C9H13BrO4/c1-12-8(11)3-2-4-9(7-10)13-5-6-14-9/h2-3H,4-7H2,1H3/b3-2+ |
| InChIKey | AQMGYKZHZCGKKG-NSCUHMNNSA-N |
| XLogP | 1.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|