About N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine
N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine (PubChem CID 153275647) has the molecular formula C13H13N3O3
and a molecular weight of 259.27 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine |
| PubChem CID | 153275647 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine |
| SMILES | COc1cc(C=NO)nc(-c2ccccn2)c1OC |
| InChI | InChI=1S/C13H13N3O3/c1-18-11-7-9(8-15-17)16-12(13(11)19-2)10-5-3-4-6-14-10/h3-8,17H,1-2H3 |
| InChIKey | WZBOHQZLZFLYKP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine?
The IUPAC name of N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine (CID 153275647) is N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine.
What is the SMILES notation for N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine?
The canonical SMILES for N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine is COc1cc(C=NO)nc(-c2ccccn2)c1OC.
What is the InChIKey of N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine?
The InChIKey is WZBOHQZLZFLYKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3/c1-18-11-7-9(8-15-17)16-12(13(11)19-2)10-5-3-4-6-14-10/h3-8,17H,1-2H3.
What are the key properties of N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine?
N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine has a molecular weight of 259.27 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,5-dimethoxy-6-pyridin-2-yl-2-pyridinyl)methylidene]hydroxylamine is sourced from PubChem (CID 153275647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).