C15H10Cl4N2 — CID 15327622
3,5-bis(2,6-dichlorophenyl)-4,5-dihydro-1H-pyrazole (PubChem CID 15327622) has the molecular formula C15H10Cl4N2 and a molecular weight of 360.07 g/mol. Its IUPAC name is 3,5-bis(2,6-dichlorophenyl)-4,5-dihydro-1H-pyrazole.
| Compound Name | 3,5-bis(2,6-dichlorophenyl)-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 15327622 |
| Molecular Formula | C15H10Cl4N2 |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 3,5-bis(2,6-dichlorophenyl)-4,5-dihydro-1H-pyrazole |
| SMILES | Clc1cccc(Cl)c1C1=NNC(c2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C15H10Cl4N2/c16-8-3-1-4-9(17)14(8)12-7-13(21-20-12)15-10(18)5-2-6-11(15)19/h1-6,12,20H,7H2 |
| InChIKey | UFLBIYJDSSTZNT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |