C25H25FN6O4 — CID 153276730
1-[(4-fluorophenyl)methyl]-5-[(3S)-5-methyl-7-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 153276730) has the molecular formula C25H25FN6O4 and a molecular weight of 492.51 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-5-[(3S)-5-methyl-7-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-5-[(3S)-5-methyl-7-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 153276730 |
| Molecular Formula | C25H25FN6O4 |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-5-[(3S)-5-methyl-7-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@@H](c2nc(C(N)=O)nn2Cc2ccc(F)cc2)COc2ccc(N3C[C@@H]4C[C@H]3CO4)cc21 |
| InChI | InChI=1S/C25H25FN6O4/c1-30-20-9-16(31-11-18-8-17(31)12-35-18)6-7-21(20)36-13-19(25(30)34)24-28-23(22(27)33)29-32(24)10-14-2-4-15(26)5-3-14/h2-7,9,17-19H,8,10-13H2,1H3,(H2,27,33)/t17-,18-,19+/m0/s1 |
| InChIKey | HQCHPVIWMJCAFN-GBESFXJTSA-N |
| XLogP | 1.68 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|