C33H28N6O4 — CID 153276803
5-benzyl-N-[(3R)-5-methyl-4-oxo-7-(4-quinolin-7-yloxybut-1-ynyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 153276803) has the molecular formula C33H28N6O4 and a molecular weight of 572.63 g/mol. Its IUPAC name is 5-benzyl-N-[(3R)-5-methyl-4-oxo-7-(4-quinolin-7-yloxybut-1-ynyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[(3R)-5-methyl-4-oxo-7-(4-quinolin-7-yloxybut-1-ynyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 153276803 |
| Molecular Formula | C33H28N6O4 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 5-benzyl-N-[(3R)-5-methyl-4-oxo-7-(4-quinolin-7-yloxybut-1-ynyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@H](NC(=O)c2n[nH]c(Cc3ccccc3)n2)COc2ccc(C#CCCOc3ccc4cccnc4c3)cc21 |
| InChI | InChI=1S/C33H28N6O4/c1-39-28-18-23(10-5-6-17-42-25-14-13-24-11-7-16-34-26(24)20-25)12-15-29(28)43-21-27(33(39)41)35-32(40)31-36-30(37-38-31)19-22-8-3-2-4-9-22/h2-4,7-9,11-16,18,20,27H,6,17,19,21H2,1H3,(H,35,40)(H,36,37,38)/t27-/m1/s1 |
| InChIKey | IHFCRHAZSMFRLX-HHHXNRCGSA-N |
| XLogP | 3.92 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|