C24H40O7Si — CID 153277452
ethyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate (PubChem CID 153277452) has the molecular formula C24H40O7Si and a molecular weight of 468.66 g/mol. Its IUPAC name is ethyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate.
| Compound Name | ethyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
|---|---|
| PubChem CID | 153277452 |
| Molecular Formula | C24H40O7Si |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | ethyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC[C@@H]2O[C@@H]([C@@H](O)/C=C/[Si](C)(C)C)[C@H]3OC4(CCCCC4)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C24H40O7Si/c1-5-27-19(26)15-16-9-10-18-21(28-16)23-22(30-24(31-23)12-7-6-8-13-24)20(29-18)17(25)11-14-32(2,3)4/h11,14,16-18,20-23,25H,5-10,12-13,15H2,1-4H3/b14-11+/t16-,17+,18+,20+,21+,22-,23+/m1/s1 |
| InChIKey | OIZAVGDVMBAYPL-NQPXHJJNSA-N |
| XLogP | 3.49 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|