About CID 153277946
CID 153277946 (PubChem CID 153277946) has the molecular formula C33H20F4N3S4+3
and a molecular weight of 662.80 g/mol.
Molecular Properties
| Compound Name | CID 153277946 |
| PubChem CID | 153277946 |
| Molecular Formula | C33H20F4N3S4+3 |
| Molecular Weight | 662.80 g/mol |
| Exact Mass | 662.05 |
| IUPAC Name | — |
| SMILES | Fc1cc(F)c2c(c1)S1(Sc3cccc[n+]3S3(Sc4cccc[n+]41)c1cc(F)cc(F)c1-c1cccc[n+]13)c1ccccc1-2 |
| InChI | InChI=1S/C33H20F4N3S4/c34-21-17-24(36)32-23-9-1-2-11-27(23)43(28(32)19-21)39-15-7-4-12-30(39)42-44(40-16-8-5-13-31(40)41-43)29-20-22(35)18-25(37)33(29)26-10-3-6-14-38(26)44/h1-20H/q+3 |
| InChIKey | QXJJNXHJXVXDKV-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 662.80 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 153277946 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153277946?
The IUPAC name of CID 153277946 (CID 153277946) is not available.
What is the SMILES notation for CID 153277946?
The canonical SMILES for CID 153277946 is Fc1cc(F)c2c(c1)S1(Sc3cccc[n+]3S3(Sc4cccc[n+]41)c1cc(F)cc(F)c1-c1cccc[n+]13)c1ccccc1-2.
What is the InChIKey of CID 153277946?
The InChIKey is QXJJNXHJXVXDKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H20F4N3S4/c34-21-17-24(36)32-23-9-1-2-11-27(23)43(28(32)19-21)39-15-7-4-12-30(39)42-44(40-16-8-5-13-31(40)41-43)29-20-22(35)18-25(37)33(29)26-10-3-6-14-38(26)44/h1-20H/q+3.
What are the key properties of CID 153277946?
CID 153277946 has a molecular weight of 662.80 g/mol, XLogP of 8.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153277946 is sourced from PubChem (CID 153277946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).