C10H6F8O2 — CID 153278148
(1,3,4,4,5,5,6,6-octafluorocyclohex-2-en-1-yl) 2-methylprop-2-enoate (PubChem CID 153278148) has the molecular formula C10H6F8O2 and a molecular weight of 310.14 g/mol. Its IUPAC name is (1,3,4,4,5,5,6,6-octafluorocyclohex-2-en-1-yl) 2-methylprop-2-enoate.
| Compound Name | (1,3,4,4,5,5,6,6-octafluorocyclohex-2-en-1-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153278148 |
| Molecular Formula | C10H6F8O2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (1,3,4,4,5,5,6,6-octafluorocyclohex-2-en-1-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(F)C=C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H6F8O2/c1-4(2)6(19)20-7(12)3-5(11)8(13,14)10(17,18)9(7,15)16/h3H,1H2,2H3 |
| InChIKey | CZLMYSPSVQZMEQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|