About 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal
3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal (PubChem CID 153278176) has the molecular formula C6H5BO6
and a molecular weight of 183.91 g/mol. Its IUPAC name is 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal.
Molecular Properties
| Compound Name | 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal |
| PubChem CID | 153278176 |
| Molecular Formula | C6H5BO6 |
| Molecular Weight | 183.91 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal |
| SMILES | CC(=CC=O)OB1OC(=O)C(=O)O1 |
| InChI | InChI=1S/C6H5BO6/c1-4(2-3-8)11-7-12-5(9)6(10)13-7/h2-3H,1H3 |
| InChIKey | PQNVEDITIHHFOW-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.91 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal?
The IUPAC name of 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal (CID 153278176) is 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal.
What is the SMILES notation for 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal?
The canonical SMILES for 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal is CC(=CC=O)OB1OC(=O)C(=O)O1.
What is the InChIKey of 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal?
The InChIKey is PQNVEDITIHHFOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BO6/c1-4(2-3-8)11-7-12-5(9)6(10)13-7/h2-3H,1H3.
What are the key properties of 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal?
3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal has a molecular weight of 183.91 g/mol, XLogP of -0.81, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-dioxo-1,3,2-dioxaborolan-2-yl)oxy]but-2-enal is sourced from PubChem (CID 153278176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).